Products 1459230-58-0
CAS 1459230-58-0 appears in our catalog under these names: N-Boc-N-methylpiperazine-d3, tert-Butyl 4-(methyl-d3)piperazine-1-carboxylate. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 50 mg, 100 mg, 10 mg, 25 mg.
Tert-butyl 4-(trideuteriomethyl)piperazine-1-carboxylate (CAS 1459230-58-0) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 203.30 g/mol. IUPAC name: tert-butyl 4-(trideuteriomethyl)piperazine-1-carboxylate. InChIKey: CJDYFMIDIQXELO-GKOSEXJESA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 203.30 g/mol |
| IUPAC name | tert-butyl 4-(trideuteriomethyl)piperazine-1-carboxylate |
| InChIKey | CJDYFMIDIQXELO-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)