CAS 1189452-53-6 appears in our catalog under these names: Bezafibrate-d4, Bezafibrate-d4, >95% (HPLC), Bezafibrate–d4. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
2-[4-[2-[(4-chloro-2,3,5,6-tetradeuteriobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoic acid (CAS 1189452-53-6) is a chemical compound with the molecular formula C19H20ClNO4 and a molecular weight of 365.8 g/mol. IUPAC name: 2-[4-[2-[(4-chloro-2,3,5,6-tetradeuteriobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoic acid. InChIKey: IIBYAHWJQTYFKB-KDWZCNHSSA-N.
| Molecular formula | C19H20ClNO4 |
|---|---|
| Molecular weight | 365.8 g/mol |
| IUPAC name | 2-[4-[2-[(4-chloro-2,3,5,6-tetradeuteriobenzoyl)amino]ethyl]phenoxy]-2-methylpropanoic acid |
| InChIKey | IIBYAHWJQTYFKB-KDWZCNHSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)NCCC2=CC=C(C=C2)OC(C)(C)C(=O)O)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)