Products 1219802-74-0
CAS 1219802-74-0 appears in our catalog under these names: Bezafibrate-d6 (dimethyl-d6), >95% (HPLC), Bezafibrate D6 (dimethyl D6), Bezafibrate-d6 (dimethyl-d6), 99 atom % D, min 98% Chemical Purity, Bezafibrate–d6, Bezafibrate-d6 (dimethyl-d6). Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, Biosynth. Available pack sizes: 0,5mg, 1mg, 5mg, 10mg, 0,05g, 0,01g, 5 mg, 1 mg.
2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid (CAS 1219802-74-0) is a chemical compound with the molecular formula C19H20ClNO4 and a molecular weight of 367.9 g/mol. IUPAC name: 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid. InChIKey: IIBYAHWJQTYFKB-WFGJKAKNSA-N.
| Molecular formula | C19H20ClNO4 |
|---|---|
| Molecular weight | 367.9 g/mol |
| IUPAC name | 2-[4-[2-[(4-chlorobenzoyl)amino]ethyl]phenoxy]-3,3,3-trideuterio-2-(trideuteriomethyl)propanoic acid |
| InChIKey | IIBYAHWJQTYFKB-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)(C([2H])([2H])[2H])OC1=CC=C(C=C1)CCNC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)