CAS 1189454-04-3 is the registry number for 5-Nitro-2-(bromoacetamido)benzophenone-d5. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-bromo-N-[4-nitro-2-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]acetamide (CAS 1189454-04-3) is a chemical compound with the molecular formula C15H11BrN2O4 and a molecular weight of 368.19 g/mol. IUPAC name: 2-bromo-N-[4-nitro-2-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]acetamide. InChIKey: USZJZGVAIGKLRF-RALIUCGRSA-N.
| Molecular formula | C15H11BrN2O4 |
|---|---|
| Molecular weight | 368.19 g/mol |
| IUPAC name | 2-bromo-N-[4-nitro-2-(2,3,4,5,6-pentadeuteriobenzoyl)phenyl]acetamide |
| InChIKey | USZJZGVAIGKLRF-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])NC(=O)CBr)[2H])[2H] |
Computed by PubChem (NCBI)