Products 303770-37-8

CAS 303770-37-8 is the registry number for 2-(2-(3-Bromobenzoyl)hydrazine-1-carbonyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[(3-bromobenzoyl)amino]carbamoyl]benzoic acid (CAS 303770-37-8) is a chemical compound with the molecular formula C15H11BrN2O4 and a molecular weight of 363.16 g/mol. IUPAC name: 2-[[(3-bromobenzoyl)amino]carbamoyl]benzoic acid. InChIKey: FDNVLEODDMIGLQ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11BrN2O4
Molecular weight363.16 g/mol
IUPAC name2-[[(3-bromobenzoyl)amino]carbamoyl]benzoic acid
InChIKeyFDNVLEODDMIGLQ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NNC(=O)C2=CC(=CC=C2)Br)C(=O)O

Computed by PubChem (NCBI)