CAS 303770-37-8 is the registry number for 2-(2-(3-Bromobenzoyl)hydrazine-1-carbonyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[(3-bromobenzoyl)amino]carbamoyl]benzoic acid (CAS 303770-37-8) is a chemical compound with the molecular formula C15H11BrN2O4 and a molecular weight of 363.16 g/mol. IUPAC name: 2-[[(3-bromobenzoyl)amino]carbamoyl]benzoic acid. InChIKey: FDNVLEODDMIGLQ-UHFFFAOYSA-N.
| Molecular formula | C15H11BrN2O4 |
|---|---|
| Molecular weight | 363.16 g/mol |
| IUPAC name | 2-[[(3-bromobenzoyl)amino]carbamoyl]benzoic acid |
| InChIKey | FDNVLEODDMIGLQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NNC(=O)C2=CC(=CC=C2)Br)C(=O)O |
Computed by PubChem (NCBI)