CAS 1189495-02-0 appears in our catalog under these names: Hydantoin-4,5-13C2-15N, Hydantoin-13C, Hydantoin-4,5-13C2,1-15N. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(4,5-13C2,115N)1,3-diazolidine-2,4-dione (CAS 1189495-02-0) is a chemical compound with the molecular formula C3H4N2O2 and a molecular weight of 103.055 g/mol. IUPAC name: (4,5-13C2,115N)1,3-diazolidine-2,4-dione. InChIKey: WJRBRSLFGCUECM-STGVANJCSA-N.
| Molecular formula | C3H4N2O2 |
|---|---|
| Molecular weight | 103.055 g/mol |
| IUPAC name | (4,5-13C2,115N)1,3-diazolidine-2,4-dione |
| InChIKey | WJRBRSLFGCUECM-STGVANJCSA-N |
| SMILES | [13CH2]1[13C](=O)NC(=O)[15NH]1 |
Computed by PubChem (NCBI)