CAS 1189697-61-7 appears in our catalog under these names: Hydantoin-15N, Hydantoin-5-13C,1-15N, >95% (HPLC), Hydantoin-5-13C,1-15N, Imidazolidine-2,4-dione-13C,15N. Offered by: Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 5 mg.
(513C,115N)1,3-diazolidine-2,4-dione (CAS 1189697-61-7) is a chemical compound with the molecular formula C3H4N2O2 and a molecular weight of 102.06 g/mol. IUPAC name: (513C,115N)1,3-diazolidine-2,4-dione. InChIKey: WJRBRSLFGCUECM-VFZPYAPFSA-N.
| Molecular formula | C3H4N2O2 |
|---|---|
| Molecular weight | 102.06 g/mol |
| IUPAC name | (513C,115N)1,3-diazolidine-2,4-dione |
| InChIKey | WJRBRSLFGCUECM-VFZPYAPFSA-N |
| SMILES | [13CH2]1C(=O)NC(=O)[15NH]1 |
Computed by PubChem (NCBI)