Products 1189552-82-6
CAS 1189552-82-6 is the registry number for MDMB–INACA 3,3–dimethylbutanoic acid metabolite. Offered by: GLPBio. Available pack sizes: 1mg.
(2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoic acid (CAS 1189552-82-6) is a chemical compound with the molecular formula C14H17N3O3 and a molecular weight of 275.30 g/mol. IUPAC name: (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoic acid. InChIKey: CPHMGHDQBWTCMZ-LLVKDONJSA-N.
| Molecular formula | C14H17N3O3 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | (2S)-2-(1H-indazole-3-carbonylamino)-3,3-dimethylbutanoic acid |
| InChIKey | CPHMGHDQBWTCMZ-LLVKDONJSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)C1=NNC2=CC=CC=C21 |
Computed by PubChem (NCBI)