CAS 1189570-45-3 appears in our catalog under these names: 1-Piperidinecarboxylic acid, 5-hydroxy-3,3-dimethyl-, 1,1-dimethylethyl ester, (5r)-, 95%, (R)-tert-Butyl 5-hydroxy-3,3-dimethylpiperidine-1-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (5R)-5-hydroxy-3,3-dimethylpiperidine-1-carboxylate (CAS 1189570-45-3) is a chemical compound with the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. IUPAC name: tert-butyl (5R)-5-hydroxy-3,3-dimethylpiperidine-1-carboxylate. InChIKey: FFWSNKPDUUDKOO-SECBINFHSA-N.
| Molecular formula | C12H23NO3 |
|---|---|
| Molecular weight | 229.32 g/mol |
| IUPAC name | tert-butyl (5R)-5-hydroxy-3,3-dimethylpiperidine-1-carboxylate |
| InChIKey | FFWSNKPDUUDKOO-SECBINFHSA-N |
| SMILES | CC1(C[C@H](CN(C1)C(=O)OC(C)(C)C)O)C |
Computed by PubChem (NCBI)