CAS 1189647-48-0 is the registry number for 8-Methoxy Loxapine-d3. Offered by: TRC. Available pack sizes: 100mg.
8-chloro-3-methoxy-6-[4-(trideuteriomethyl)piperazin-1-yl]benzo[b][1,4]benzoxazepine (CAS 1189647-48-0) is a chemical compound with the molecular formula C19H20ClN3O2 and a molecular weight of 360.9 g/mol. IUPAC name: 8-chloro-3-methoxy-6-[4-(trideuteriomethyl)piperazin-1-yl]benzo[b][1,4]benzoxazepine. InChIKey: CQTLHLYDQYOEJW-FIBGUPNXSA-N.
| Molecular formula | C19H20ClN3O2 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 8-chloro-3-methoxy-6-[4-(trideuteriomethyl)piperazin-1-yl]benzo[b][1,4]benzoxazepine |
| InChIKey | CQTLHLYDQYOEJW-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=NC3=C(C=CC(=C3)OC)OC4=C2C=C(C=C4)Cl |
Computed by PubChem (NCBI)