CAS 200195-01-3 is the registry number for PD 172760. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-4H-1,4-benzoxazin-3-one (CAS 200195-01-3) is a chemical compound with the molecular formula C19H20ClN3O2 and a molecular weight of 357.8 g/mol. IUPAC name: 7-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-4H-1,4-benzoxazin-3-one. InChIKey: UFFHNEZNXKJHFB-UHFFFAOYSA-N.
| Molecular formula | C19H20ClN3O2 |
|---|---|
| Molecular weight | 357.8 g/mol |
| IUPAC name | 7-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-4H-1,4-benzoxazin-3-one |
| InChIKey | UFFHNEZNXKJHFB-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC3=C(C=C2)NC(=O)CO3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)