Products 1189648-08-5
CAS 1189648-08-5 appears in our catalog under these names: Melitracen-d6 (Benzyl position) HCl, Melitracen-d6 Hydrochloride, >95% (HPLC), Melitracen-d6 (hydrochloride). Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 10 mg, 1 mg.
3-[10,10-bis(trideuteriomethyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine;hydrochloride (CAS 1189648-08-5) is a chemical compound with the molecular formula C21H26ClN and a molecular weight of 333.9 g/mol. IUPAC name: 3-[10,10-bis(trideuteriomethyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine;hydrochloride. InChIKey: RADLXCPDUXFGFF-TXHXQZCNSA-N.
| Molecular formula | C21H26ClN |
|---|---|
| Molecular weight | 333.9 g/mol |
| IUPAC name | 3-[10,10-bis(trideuteriomethyl)anthracen-9-ylidene]-N,N-dimethylpropan-1-amine;hydrochloride |
| InChIKey | RADLXCPDUXFGFF-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])C1(C2=CC=CC=C2C(=CCCN(C)C)C3=CC=CC=C31)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)