CAS 1310012-15-7 appears in our catalog under these names: Terbinafine-d3 HCl (N-methyl-d3), Terbinafine-d3 HCl (N-methyl-d3), >95% (HPLC), Terbinafine-d3 HCl (N-methyl-d3), 98 atom % D, min 98% Chemical Purity, Terbinafine–d3 (hydrochloride), Terbinafine-d3 (hydrochloride), 99.87%. Offered by: Hubei YoungXin, TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 0,01g, 0,005g.
(E)-6,6-dimethyl-N-(naphthalen-1-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine;hydrochloride (CAS 1310012-15-7) is a chemical compound with the molecular formula C21H26ClN and a molecular weight of 330.9 g/mol. IUPAC name: (E)-6,6-dimethyl-N-(naphthalen-1-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine;hydrochloride. InChIKey: BWMISRWJRUSYEX-YOVIYTQZSA-N.
| Molecular formula | C21H26ClN |
|---|---|
| Molecular weight | 330.9 g/mol |
| IUPAC name | (E)-6,6-dimethyl-N-(naphthalen-1-ylmethyl)-N-(trideuteriomethyl)hept-2-en-4-yn-1-amine;hydrochloride |
| InChIKey | BWMISRWJRUSYEX-YOVIYTQZSA-N |
| SMILES | [2H]C([2H])([2H])N(C/C=C/C#CC(C)(C)C)CC1=CC=CC2=CC=CC=C21.Cl |
Computed by PubChem (NCBI)