Products 1189652-25-2
CAS 1189652-25-2 appears in our catalog under these names: 5-(2-Bromoethyl-d4)-2,3-dihydrobenzofuran, 5-(2-Bromoethyl-1,1,2,2-d4)-2,3-dihydrobenzofuran. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
5-(2-bromo-1,1,2,2-tetradeuterioethyl)-2,3-dihydro-1-benzofuran (CAS 1189652-25-2) is a chemical compound with the molecular formula C10H11BrO and a molecular weight of 231.12 g/mol. IUPAC name: 5-(2-bromo-1,1,2,2-tetradeuterioethyl)-2,3-dihydro-1-benzofuran. InChIKey: JRKZQRRYNCMSCB-JAJFWILCSA-N.
| Molecular formula | C10H11BrO |
|---|---|
| Molecular weight | 231.12 g/mol |
| IUPAC name | 5-(2-bromo-1,1,2,2-tetradeuterioethyl)-2,3-dihydro-1-benzofuran |
| InChIKey | JRKZQRRYNCMSCB-JAJFWILCSA-N |
| SMILES | [2H]C([2H])(C1=CC2=C(C=C1)OCC2)C([2H])([2H])Br |
Computed by PubChem (NCBI)