Products 1189671-27-9
CAS 1189671-27-9 appears in our catalog under these names: Amoxapine-d8, >95% (HPLC), Amoxapine-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
8-chloro-6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)benzo[b][1,4]benzoxazepine (CAS 1189671-27-9) is a chemical compound with the molecular formula C17H16ClN3O and a molecular weight of 321.8 g/mol. IUPAC name: 8-chloro-6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)benzo[b][1,4]benzoxazepine. InChIKey: QWGDMFLQWFTERH-UFBJYANTSA-N.
| Molecular formula | C17H16ClN3O |
|---|---|
| Molecular weight | 321.8 g/mol |
| IUPAC name | 8-chloro-6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)benzo[b][1,4]benzoxazepine |
| InChIKey | QWGDMFLQWFTERH-UFBJYANTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=NC3=CC=CC=C3OC4=C2C=C(C=C4)Cl)([2H])[2H])[2H] |
Computed by PubChem (NCBI)