CAS 3693-14-9 is the registry number for N-Methyl Chlordiazepoxide. Offered by: TRC. Available pack sizes: 125mg, 25mg, 50mg.
7-chloro-N,N-dimethyl-4-oxido-5-phenyl-3H-1,4-benzodiazepin-4-ium-2-amine (CAS 3693-14-9) is a chemical compound with the molecular formula C17H16ClN3O and a molecular weight of 313.8 g/mol. IUPAC name: 7-chloro-N,N-dimethyl-4-oxido-5-phenyl-3H-1,4-benzodiazepin-4-ium-2-amine. InChIKey: DQZUAVXXQQOPOW-UHFFFAOYSA-N.
| Molecular formula | C17H16ClN3O |
|---|---|
| Molecular weight | 313.8 g/mol |
| IUPAC name | 7-chloro-N,N-dimethyl-4-oxido-5-phenyl-3H-1,4-benzodiazepin-4-ium-2-amine |
| InChIKey | DQZUAVXXQQOPOW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=C(C=C(C=C2)Cl)C(=[N+](C1)[O-])C3=CC=CC=C3 |
Computed by PubChem (NCBI)