Products 1189671-34-8
CAS 1189671-34-8 appears in our catalog under these names: Chlorguanide-d4 Hydrochloride, >95% (HPLC), Proguanil-d4 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
1-[N'-(4-chloro-2,3,5,6-tetradeuteriophenyl)carbamimidoyl]-2-propan-2-ylguanidine;hydrochloride (CAS 1189671-34-8) is a chemical compound with the molecular formula C11H17Cl2N5 and a molecular weight of 294.21 g/mol. IUPAC name: 1-[N'-(4-chloro-2,3,5,6-tetradeuteriophenyl)carbamimidoyl]-2-propan-2-ylguanidine;hydrochloride. InChIKey: SARMGXPVOFNNNG-HGSONKNXSA-N.
| Molecular formula | C11H17Cl2N5 |
|---|---|
| Molecular weight | 294.21 g/mol |
| IUPAC name | 1-[N'-(4-chloro-2,3,5,6-tetradeuteriophenyl)carbamimidoyl]-2-propan-2-ylguanidine;hydrochloride |
| InChIKey | SARMGXPVOFNNNG-HGSONKNXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N=C(N)NC(=NC(C)C)N)[2H])[2H])Cl)[2H].Cl |
Computed by PubChem (NCBI)