CAS 637-32-1 appears in our catalog under these names: Proguanil–d6 hydrochloride, Chlorguanide Hydrochloride, >95% (HPLC), Proguanil Hydrochloride, Proguanil hydrochloride, Proguanil hydrochloride, 97%. Offered by: GLPBio, TRC, Mikromol, LoGiCal, Biosynth. Available pack sizes: 1mg, 100mg, 25mg, 250mg, 10mg, 5mg, 50mg, 0,025g.
(1E)-1-[amino-(4-chloroanilino)methylidene]-2-propan-2-ylguanidine;hydrochloride (CAS 637-32-1) is a chemical compound with the molecular formula C11H17Cl2N5 and a molecular weight of 290.19 g/mol. IUPAC name: (1E)-1-[amino-(4-chloroanilino)methylidene]-2-propan-2-ylguanidine;hydrochloride. InChIKey: SARMGXPVOFNNNG-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N5 |
|---|---|
| Molecular weight | 290.19 g/mol |
| IUPAC name | (1E)-1-[amino-(4-chloroanilino)methylidene]-2-propan-2-ylguanidine;hydrochloride |
| InChIKey | SARMGXPVOFNNNG-UHFFFAOYSA-N |
| SMILES | CC(C)N=C(N)/N=C(\N)/NC1=CC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)