CAS 1071546-52-5 appears in our catalog under these names: 1–(3–Chlorophenyl)–5–isopropyl Biguanide Hydrochloride, 1-(3-Chlorophenyl)-5-isopropyl biguanide hydrochloride, 97%, Proguanil Impurity 7（Proguanil USP RC G）, 1-(3-Chlorophenyl)-5-isopropyl Biguanide Hydrochloride, >95% (HPLC), 1-(3-Chlorophenyl)-5-isopropyl Biguanide Hydrochloride, 98%, 98%. Offered by: GLPBio, Chemat Brand, Hubei YoungXin, TRC, Chemat. Available pack sizes: 10mg, 50mg, on request, 25mg, 100mg, 200mg, 500mg.
(1E)-1-[amino-(3-chloroanilino)methylidene]-2-propan-2-ylguanidine;hydrochloride (CAS 1071546-52-5) is a chemical compound with the molecular formula C11H17Cl2N5 and a molecular weight of 290.19 g/mol. IUPAC name: (1E)-1-[amino-(3-chloroanilino)methylidene]-2-propan-2-ylguanidine;hydrochloride. InChIKey: TUBIBEKUWYLPLO-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N5 |
|---|---|
| Molecular weight | 290.19 g/mol |
| IUPAC name | (1E)-1-[amino-(3-chloroanilino)methylidene]-2-propan-2-ylguanidine;hydrochloride |
| InChIKey | TUBIBEKUWYLPLO-UHFFFAOYSA-N |
| SMILES | CC(C)N=C(N)/N=C(\N)/NC1=CC(=CC=C1)Cl.Cl |
Computed by PubChem (NCBI)