Products 1189675-28-2
CAS 1189675-28-2 appears in our catalog under these names: 4’-Hydroxyphenyl Carvedilol-d3, >95% (HPLC), 4’-Hydroxyphenyl Carvedilol-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
4-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]-3-(trideuteriomethoxy)phenol (CAS 1189675-28-2) is a chemical compound with the molecular formula C24H26N2O5 and a molecular weight of 425.5 g/mol. IUPAC name: 4-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]-3-(trideuteriomethoxy)phenol. InChIKey: ZCJHEORDHXCJNB-FIBGUPNXSA-N.
| Molecular formula | C24H26N2O5 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | 4-[2-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]amino]ethoxy]-3-(trideuteriomethoxy)phenol |
| InChIKey | ZCJHEORDHXCJNB-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=CC(=C1)O)OCCNCC(COC2=CC=CC3=C2C4=CC=CC=C4N3)O |
Computed by PubChem (NCBI)