Products 1189693-23-9
CAS 1189693-23-9 appears in our catalog under these names: Oxyphenbutazone-d9, >95% (HPLC), Oxyphenbutazone-d9 (n-butyl-d9), 99 atom % D, min 98% Chemical Purity, Oxyphenbutazone-d9. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,01g, 0,005g, 1 mg, 10 mg.
1-(4-hydroxyphenyl)-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)-2-phenylpyrazolidine-3,5-dione (CAS 1189693-23-9) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 333.4 g/mol. IUPAC name: 1-(4-hydroxyphenyl)-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)-2-phenylpyrazolidine-3,5-dione. InChIKey: HFHZKZSRXITVMK-ZNZAITRCSA-N.
| Molecular formula | C19H20N2O3 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 1-(4-hydroxyphenyl)-4-(1,1,2,2,3,3,4,4,4-nonadeuteriobutyl)-2-phenylpyrazolidine-3,5-dione |
| InChIKey | HFHZKZSRXITVMK-ZNZAITRCSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1C(=O)N(N(C1=O)C2=CC=C(C=C2)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)