CAS 1189702-86-0 is the registry number for 7-Hydroxy Coumarin-13C6 Sulfate Potassium Salt. Offered by: TRC. Available pack sizes: 0,25mg, 2,5mg.
Potassium (2-oxochromen-7-yl) sulfate (CAS 1189702-86-0) is a chemical compound with the molecular formula C9H5KO6S and a molecular weight of 286.25 g/mol. IUPAC name: potassium (2-oxochromen-7-yl) sulfate. InChIKey: SVUZPRLQAASRKC-CVLAVSJCSA-M.
| Molecular formula | C9H5KO6S |
|---|---|
| Molecular weight | 286.25 g/mol |
| IUPAC name | potassium (2-oxochromen-7-yl) sulfate |
| InChIKey | SVUZPRLQAASRKC-CVLAVSJCSA-M |
| SMILES | C1=C[13C]2=[13C]([13CH]=[13C]([13CH]=[13CH]2)OS(=O)(=O)[O-])OC1=O.[K+] |
Computed by PubChem (NCBI)