Products 1261392-49-7
CAS 1261392-49-7 appears in our catalog under these names: 7-Hydroxy coumarin sulfate-d5 (potassium), 7-Hydroxy Coumarin-d5 Sulfate Potassium Salt, >95% (HPLC). Offered by: MedChemExpress, TRC. Available pack sizes: 2.5 mg, 25 mg, 2,5mg, 25mg.
Potassium (3,4,5,6,8-pentadeuterio-2-oxochromen-7-yl) sulfate (CAS 1261392-49-7) is a chemical compound with the molecular formula C9H5KO6S and a molecular weight of 285.33 g/mol. IUPAC name: potassium (3,4,5,6,8-pentadeuterio-2-oxochromen-7-yl) sulfate. InChIKey: SVUZPRLQAASRKC-GWVWGMRQSA-M.
| Molecular formula | C9H5KO6S |
|---|---|
| Molecular weight | 285.33 g/mol |
| IUPAC name | potassium (3,4,5,6,8-pentadeuterio-2-oxochromen-7-yl) sulfate |
| InChIKey | SVUZPRLQAASRKC-GWVWGMRQSA-M |
| SMILES | [2H]C1=C(C(=C(C2=C1C(=C(C(=O)O2)[2H])[2H])[2H])OS(=O)(=O)[O-])[2H].[K+] |
Computed by PubChem (NCBI)