Products 1189703-33-0
CAS 1189703-33-0 appears in our catalog under these names: Ethosuximide-d3, Ethosuximide-d3, >95% (GC), Ethosuximide-d3, 99.0%. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 1 mg.
3-methyl-3-(2,2,2-trideuterioethyl)pyrrolidine-2,5-dione (CAS 1189703-33-0) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 144.19 g/mol. IUPAC name: 3-methyl-3-(2,2,2-trideuterioethyl)pyrrolidine-2,5-dione. InChIKey: HAPOVYFOVVWLRS-FIBGUPNXSA-N.
| Molecular formula | C7H11NO2 |
|---|---|
| Molecular weight | 144.19 g/mol |
| IUPAC name | 3-methyl-3-(2,2,2-trideuterioethyl)pyrrolidine-2,5-dione |
| InChIKey | HAPOVYFOVVWLRS-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC1(CC(=O)NC1=O)C |
Computed by PubChem (NCBI)