Products 1989660-59-4
CAS 1989660-59-4 appears in our catalog under these names: Ethosuximide–d5, Ethosuximide-d5. Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 1 mg.
3-methyl-3-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2,5-dione (CAS 1989660-59-4) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 146.20 g/mol. IUPAC name: 3-methyl-3-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2,5-dione. InChIKey: HAPOVYFOVVWLRS-WNWXXORZSA-N.
| Molecular formula | C7H11NO2 |
|---|---|
| Molecular weight | 146.20 g/mol |
| IUPAC name | 3-methyl-3-(1,1,2,2,2-pentadeuterioethyl)pyrrolidine-2,5-dione |
| InChIKey | HAPOVYFOVVWLRS-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1(CC(=O)NC1=O)C |
Computed by PubChem (NCBI)