CAS 1189704-56-0 appears in our catalog under these names: 2–Bromo–5–phenoxypyrazine, 2-Bromo-5-phenoxypyrazine. Offered by: GLPBio, Biosynth. Available pack sizes: 10mg, 50mg, 0,5g.
2-bromo-5-phenoxypyrazine (CAS 1189704-56-0) is a chemical compound with the molecular formula C10H7BrN2O and a molecular weight of 251.08 g/mol. IUPAC name: 2-bromo-5-phenoxypyrazine. InChIKey: APZCCTWVBMVYJN-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 2-bromo-5-phenoxypyrazine |
| InChIKey | APZCCTWVBMVYJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CN=C(C=N2)Br |
Computed by PubChem (NCBI)