Products 1189706-86-2
CAS 1189706-86-2 appears in our catalog under these names: Dibenzazepinone-d4 (Major), >95% (HPLC), Dibenzazepinone-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
1,2,3,4-tetradeuterio-5,11-dihydrobenzo[b][1]benzazepin-6-one (CAS 1189706-86-2) is a chemical compound with the molecular formula C14H11NO and a molecular weight of 213.27 g/mol. IUPAC name: 1,2,3,4-tetradeuterio-5,11-dihydrobenzo[b][1]benzazepin-6-one. InChIKey: VSZGCLXGCOECAY-DNZPNURCSA-N.
| Molecular formula | C14H11NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | 1,2,3,4-tetradeuterio-5,11-dihydrobenzo[b][1]benzazepin-6-one |
| InChIKey | VSZGCLXGCOECAY-DNZPNURCSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])CC(=O)C3=CC=CC=C3N2)[2H])[2H] |
Computed by PubChem (NCBI)