Products 1189715-10-3
CAS 1189715-10-3 is the registry number for 2-Methyl-d3-3-(trifluoromethyl)pivalanilide. Offered by: TRC. Available pack sizes: 250mg, 25mg.
2,2-dimethyl-N-[2-(trideuteriomethyl)-3-(trifluoromethyl)phenyl]propanamide (CAS 1189715-10-3) is a chemical compound with the molecular formula C13H16F3NO and a molecular weight of 262.29 g/mol. IUPAC name: 2,2-dimethyl-N-[2-(trideuteriomethyl)-3-(trifluoromethyl)phenyl]propanamide. InChIKey: BTZICTAKSVSHCJ-FIBGUPNXSA-N.
| Molecular formula | C13H16F3NO |
|---|---|
| Molecular weight | 262.29 g/mol |
| IUPAC name | 2,2-dimethyl-N-[2-(trideuteriomethyl)-3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | BTZICTAKSVSHCJ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C=CC=C1NC(=O)C(C)(C)C)C(F)(F)F |
Computed by PubChem (NCBI)