CAS 150783-50-9 is the registry number for 2-Methyl-3-(trifluoromethyl)pivalanilide. Offered by: TRC. Available pack sizes: 100mg, 1g.
2,2-dimethyl-N-[2-methyl-3-(trifluoromethyl)phenyl]propanamide (CAS 150783-50-9) is a chemical compound with the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. IUPAC name: 2,2-dimethyl-N-[2-methyl-3-(trifluoromethyl)phenyl]propanamide. InChIKey: BTZICTAKSVSHCJ-UHFFFAOYSA-N.
| Molecular formula | C13H16F3NO |
|---|---|
| Molecular weight | 259.27 g/mol |
| IUPAC name | 2,2-dimethyl-N-[2-methyl-3-(trifluoromethyl)phenyl]propanamide |
| InChIKey | BTZICTAKSVSHCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1NC(=O)C(C)(C)C)C(F)(F)F |
Computed by PubChem (NCBI)