Products 1189722-51-7
CAS 1189722-51-7 is the registry number for Dihydro Ketoprofen-13C,d3(Mixture of Diastereomers). Offered by: TRC. Available pack sizes: 25mg.
3,3,3-trideuterio-2-[3-[hydroxy(phenyl)methyl]phenyl](313C)propanoic acid (CAS 1189722-51-7) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 260.31 g/mol. IUPAC name: 3,3,3-trideuterio-2-[3-[hydroxy(phenyl)methyl]phenyl](313C)propanoic acid. InChIKey: KBVIDAVUDXDUPS-KQORAOOSSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 260.31 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-[3-[hydroxy(phenyl)methyl]phenyl](313C)propanoic acid |
| InChIKey | KBVIDAVUDXDUPS-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])C(C1=CC(=CC=C1)C(C2=CC=CC=C2)O)C(=O)O |
Computed by PubChem (NCBI)