CAS 59960-32-6 appears in our catalog under these names: Ketoprofen Impurity 5, Dihydro Ketoprofen (Mixture of Diastereomers), >95% (HPLC), Dihydro Ketoprofen(Mixture of Diastereomers), >95% (HPLC), 2-(3-(alpha-Hydroxybenzyl)phenyl)propanoic Acid, 2–(3–(Hydroxy(phenyl)methyl)phenyl)propanoic acid. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Ambeed. Available pack sizes: on request, 2,5mg, 25mg, 100mg, 250mg, 1g, 5g, 10g.
2-[3-[hydroxy(phenyl)methyl]phenyl]propanoic acid (CAS 59960-32-6) is a chemical compound with the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. IUPAC name: 2-[3-[hydroxy(phenyl)methyl]phenyl]propanoic acid. InChIKey: KBVIDAVUDXDUPS-UHFFFAOYSA-N.
| Molecular formula | C16H16O3 |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 2-[3-[hydroxy(phenyl)methyl]phenyl]propanoic acid |
| InChIKey | KBVIDAVUDXDUPS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)C(C2=CC=CC=C2)O)C(=O)O |
Computed by PubChem (NCBI)