CAS 1189729-40-5 appears in our catalog under these names: Losartan-d3 Carboxylic Acid, >95% (HPLC), Losartan-d3 carboxylic acid. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2-(4,4,4-trideuteriobutyl)imidazole-4-carboxylic acid (CAS 1189729-40-5) is a chemical compound with the molecular formula C22H21ClN6O2 and a molecular weight of 439.9 g/mol. IUPAC name: 5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2-(4,4,4-trideuteriobutyl)imidazole-4-carboxylic acid. InChIKey: ZEUXAIYYDDCIRX-FIBGUPNXSA-N.
| Molecular formula | C22H21ClN6O2 |
|---|---|
| Molecular weight | 439.9 g/mol |
| IUPAC name | 5-chloro-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-2-(4,4,4-trideuteriobutyl)imidazole-4-carboxylic acid |
| InChIKey | ZEUXAIYYDDCIRX-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NNN=N4)C(=O)O)Cl |
Computed by PubChem (NCBI)