Products 1246820-62-1
CAS 1246820-62-1 appears in our catalog under these names: Losartan Carboxylic Acid-d4, Losartan-d4 Carboxylic Acid, >95% (HPLC), Losartan-d4 (carboxylic acid), 98.09%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 5 mg.
2-butyl-5-chloro-3-[[2,3,5,6-tetradeuterio-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid (CAS 1246820-62-1) is a chemical compound with the molecular formula C22H21ClN6O2 and a molecular weight of 440.9 g/mol. IUPAC name: 2-butyl-5-chloro-3-[[2,3,5,6-tetradeuterio-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid. InChIKey: ZEUXAIYYDDCIRX-IRYCTXJYSA-N.
| Molecular formula | C22H21ClN6O2 |
|---|---|
| Molecular weight | 440.9 g/mol |
| IUPAC name | 2-butyl-5-chloro-3-[[2,3,5,6-tetradeuterio-4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxylic acid |
| InChIKey | ZEUXAIYYDDCIRX-IRYCTXJYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1CN2C(=NC(=C2C(=O)O)Cl)CCCC)[2H])[2H])C3=CC=CC=C3C4=NNN=N4)[2H] |
Computed by PubChem (NCBI)