CAS 1189732-75-9 appears in our catalog under these names: Olanzapine-d3 N-Oxide, >95% (HPLC), Olanzapine-d3 N-oxide, Olanzapine N-Oxide-d3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
2-methyl-4-[4-oxido-4-(trideuteriomethyl)piperazin-4-ium-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine (CAS 1189732-75-9) is a chemical compound with the molecular formula C17H20N4OS and a molecular weight of 331.5 g/mol. IUPAC name: 2-methyl-4-[4-oxido-4-(trideuteriomethyl)piperazin-4-ium-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine. InChIKey: LJVNYCDXBXGQIK-BMSJAHLVSA-N.
| Molecular formula | C17H20N4OS |
|---|---|
| Molecular weight | 331.5 g/mol |
| IUPAC name | 2-methyl-4-[4-oxido-4-(trideuteriomethyl)piperazin-4-ium-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepine |
| InChIKey | LJVNYCDXBXGQIK-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])[N+]1(CCN(CC1)C2=NC3=CC=CC=C3NC4=C2C=C(S4)C)[O-] |
Computed by PubChem (NCBI)