Products 1190006-36-0
CAS 1190006-36-0 appears in our catalog under these names: 2-Hydroxymethyl Olanzapine-d3 (Major), >95% (HPLC), 2-Hydroxymethyl olanzapine-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
[4-[4-(trideuteriomethyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepin-2-yl]methanol (CAS 1190006-36-0) is a chemical compound with the molecular formula C17H20N4OS and a molecular weight of 331.5 g/mol. IUPAC name: [4-[4-(trideuteriomethyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepin-2-yl]methanol. InChIKey: FPDIERBPQFAFSI-FIBGUPNXSA-N.
| Molecular formula | C17H20N4OS |
|---|---|
| Molecular weight | 331.5 g/mol |
| IUPAC name | [4-[4-(trideuteriomethyl)piperazin-1-yl]-10H-thieno[2,3-b][1,5]benzodiazepin-2-yl]methanol |
| InChIKey | FPDIERBPQFAFSI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)C2=NC3=CC=CC=C3NC4=C2C=C(S4)CO |
Computed by PubChem (NCBI)