Products 1189749-71-0

CAS 1189749-71-0 is the registry number for 2-Methoxy-5-(1h-pyrazol-1-yl)benzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-methoxy-5-pyrazol-1-ylbenzenesulfonyl chloride (CAS 1189749-71-0) is a chemical compound with the molecular formula C10H9ClN2O3S and a molecular weight of 272.71 g/mol. IUPAC name: 2-methoxy-5-pyrazol-1-ylbenzenesulfonyl chloride. InChIKey: KUDGOSQVGJNNQS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClN2O3S
Molecular weight272.71 g/mol
IUPAC name2-methoxy-5-pyrazol-1-ylbenzenesulfonyl chloride
InChIKeyKUDGOSQVGJNNQS-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)N2C=CC=N2)S(=O)(=O)Cl

Computed by PubChem (NCBI)