Products 1216060-68-2
CAS 1216060-68-2 appears in our catalog under these names: 1-(2-Methoxyphenyl)-1H-pyrazole-4-sulfonyl chloride, 1-(2-Methoxyphenyl)-1H-pyrazole-4-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
1-(2-methoxyphenyl)pyrazole-4-sulfonyl chloride (CAS 1216060-68-2) is a chemical compound with the molecular formula C10H9ClN2O3S and a molecular weight of 272.71 g/mol. IUPAC name: 1-(2-methoxyphenyl)pyrazole-4-sulfonyl chloride. InChIKey: KJLBRVABZVYDNL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O3S |
|---|---|
| Molecular weight | 272.71 g/mol |
| IUPAC name | 1-(2-methoxyphenyl)pyrazole-4-sulfonyl chloride |
| InChIKey | KJLBRVABZVYDNL-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2C=C(C=N2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)