CAS 1189805-15-9 is the registry number for Proguanil-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(1E)-1-[amino-(4-chloro-2,3,5,6-tetradeuterioanilino)methylidene]-2-propan-2-ylguanidine (CAS 1189805-15-9) is a chemical compound with the molecular formula C11H16ClN5 and a molecular weight of 257.75 g/mol. IUPAC name: (1E)-1-[amino-(4-chloro-2,3,5,6-tetradeuterioanilino)methylidene]-2-propan-2-ylguanidine. InChIKey: SSOLNOMRVKKSON-LNFUJOGGSA-N.
| Molecular formula | C11H16ClN5 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | (1E)-1-[amino-(4-chloro-2,3,5,6-tetradeuterioanilino)methylidene]-2-propan-2-ylguanidine |
| InChIKey | SSOLNOMRVKKSON-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N/C(=N/C(=NC(C)C)N)/N)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)