CAS 1461707-57-2 is the registry number for 3-Methyl-4-(5-(propan-2-yl)-1H-1,2,3,4-tetrazol-1-yl)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-methyl-4-(5-propan-2-yltetrazol-1-yl)aniline;hydrochloride (CAS 1461707-57-2) is a chemical compound with the molecular formula C11H16ClN5 and a molecular weight of 253.73 g/mol. IUPAC name: 3-methyl-4-(5-propan-2-yltetrazol-1-yl)aniline;hydrochloride. InChIKey: AFXABUHHYMISMK-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN5 |
|---|---|
| Molecular weight | 253.73 g/mol |
| IUPAC name | 3-methyl-4-(5-propan-2-yltetrazol-1-yl)aniline;hydrochloride |
| InChIKey | AFXABUHHYMISMK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)N2C(=NN=N2)C(C)C.Cl |
Computed by PubChem (NCBI)