Products 1189869-04-2

CAS 1189869-04-2 is the registry number for 1-(3-Aminopropyl)-3-phenylurea hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.

Structural formula: {0} (CAS {1})

1-(3-aminopropyl)-3-phenylurea;hydrochloride (CAS 1189869-04-2) is a chemical compound with the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. IUPAC name: 1-(3-aminopropyl)-3-phenylurea;hydrochloride. InChIKey: FFTROQIITUUMDV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16ClN3O
Molecular weight229.71 g/mol
IUPAC name1-(3-aminopropyl)-3-phenylurea;hydrochloride
InChIKeyFFTROQIITUUMDV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)NC(=O)NCCCN.Cl

Computed by PubChem (NCBI)