CAS 1385696-48-9 appears in our catalog under these names: 2-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)piperidine hydrochloride, 95%, 3-Cyclopropyl-5-(piperidin-2-yl)-1,2,4-oxadiazole hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
3-cyclopropyl-5-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride (CAS 1385696-48-9) is a chemical compound with the molecular formula C10H16ClN3O and a molecular weight of 229.71 g/mol. IUPAC name: 3-cyclopropyl-5-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride. InChIKey: GMKSAWBCAXFZAC-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3O |
|---|---|
| Molecular weight | 229.71 g/mol |
| IUPAC name | 3-cyclopropyl-5-piperidin-2-yl-1,2,4-oxadiazole;hydrochloride |
| InChIKey | GMKSAWBCAXFZAC-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=NC(=NO2)C3CC3.Cl |
Computed by PubChem (NCBI)