Products 1189876-34-3
CAS 1189876-34-3 is the registry number for 1，3–Adamantanedimethanol–d4. Offered by: GLPBio. Available pack sizes: 5mg.
Dideuterio-[3-[dideuterio(hydroxy)methyl]-1-adamantyl]methanol (CAS 1189876-34-3) is a chemical compound with the molecular formula C12H20O2 and a molecular weight of 200.31 g/mol. IUPAC name: dideuterio-[3-[dideuterio(hydroxy)methyl]-1-adamantyl]methanol. InChIKey: RABVYVVNRHVXPJ-OSEHSPPNSA-N.
| Molecular formula | C12H20O2 |
|---|---|
| Molecular weight | 200.31 g/mol |
| IUPAC name | dideuterio-[3-[dideuterio(hydroxy)methyl]-1-adamantyl]methanol |
| InChIKey | RABVYVVNRHVXPJ-OSEHSPPNSA-N |
| SMILES | [2H]C([2H])(C12CC3CC(C1)CC(C3)(C2)C([2H])([2H])O)O |
Computed by PubChem (NCBI)