Products 1189879-32-0
CAS 1189879-32-0 appears in our catalog under these names: 2-(Ethylamino)propiophenone-d5 Hydrochloride, >95% (HPLC), (±)-2-Propiophenone hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
2-(1,1,2,2,2-pentadeuterioethylamino)-1-phenylpropan-1-one;hydrochloride (CAS 1189879-32-0) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 218.73 g/mol. IUPAC name: 2-(1,1,2,2,2-pentadeuterioethylamino)-1-phenylpropan-1-one;hydrochloride. InChIKey: XCVDYVFUJZVVKL-IYSLTCQOSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 218.73 g/mol |
| IUPAC name | 2-(1,1,2,2,2-pentadeuterioethylamino)-1-phenylpropan-1-one;hydrochloride |
| InChIKey | XCVDYVFUJZVVKL-IYSLTCQOSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC(C)C(=O)C1=CC=CC=C1.Cl |
Computed by PubChem (NCBI)