Products 1189891-99-3
CAS 1189891-99-3 appears in our catalog under these names: N-Acetyl Sulfamethazine-d4, N–Acetyl Sulfamethazine–d4, N-Acetyl sulfamethazine-d4, 0.98%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 50mg, 1 mg.
N-[2,3,5,6-tetradeuterio-4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide (CAS 1189891-99-3) is a chemical compound with the molecular formula C14H16N4O3S and a molecular weight of 324.39 g/mol. IUPAC name: N-[2,3,5,6-tetradeuterio-4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide. InChIKey: LJKAKWDUZRJNPJ-UGWFXTGHSA-N.
| Molecular formula | C14H16N4O3S |
|---|---|
| Molecular weight | 324.39 g/mol |
| IUPAC name | N-[2,3,5,6-tetradeuterio-4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]acetamide |
| InChIKey | LJKAKWDUZRJNPJ-UGWFXTGHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)C)[2H])[2H])S(=O)(=O)NC2=NC(=CC(=N2)C)C)[2H] |
Computed by PubChem (NCBI)
Synonyms:
N-Acetyl Sulfamethazine-d4