CAS 33288-71-0 appears in our catalog under these names: 2-[4-Aminosulfonyl-phenyl]-ethyl-5-methylpyrazinecarboxamide, 95%, Glipizide Impurity A(EP), Glipizide EP Impurity A, 4-(b-(5-Methylpyrazinyl-2-carboxamido)ethyl)benzene Sulfonamide, >95% (HPLC), 4-(beta-(5-Methylpyrazinyl-2-carboxamido)ethyl)benzene Sulfonamide, >95% (HPLC). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 100mg, 1g, 250mg, on request, 2,5g, 500mg, 50mg, 25mg.
5-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrazine-2-carboxamide (CAS 33288-71-0) is a chemical compound with the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. IUPAC name: 5-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrazine-2-carboxamide. InChIKey: IMEZLHZLIANIAS-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O3S |
|---|---|
| Molecular weight | 320.37 g/mol |
| IUPAC name | 5-methyl-N-[2-(4-sulfamoylphenyl)ethyl]pyrazine-2-carboxamide |
| InChIKey | IMEZLHZLIANIAS-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=N1)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)