CAS 1189916-55-9 is the registry number for O-Desmethyl Indomethacin-d4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 10 mg.
2-[1-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetic acid (CAS 1189916-55-9) is a chemical compound with the molecular formula C18H14ClNO4 and a molecular weight of 347.8 g/mol. IUPAC name: 2-[1-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetic acid. InChIKey: KMLNWQPYFBIALN-QFFDRWTDSA-N.
| Molecular formula | C18H14ClNO4 |
|---|---|
| Molecular weight | 347.8 g/mol |
| IUPAC name | 2-[1-(4-chloro-2,3,5,6-tetradeuteriobenzoyl)-5-hydroxy-2-methylindol-3-yl]acetic acid |
| InChIKey | KMLNWQPYFBIALN-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)N2C(=C(C3=C2C=CC(=C3)O)CC(=O)O)C)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)