CAS 1326902-13-9 is the registry number for 3-(4-Chlorobenzoyl)-6,7-dimethoxyquinolin-4(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-chlorobenzoyl)-6,7-dimethoxy-1H-quinolin-4-one (CAS 1326902-13-9) is a chemical compound with the molecular formula C18H14ClNO4 and a molecular weight of 343.8 g/mol. IUPAC name: 3-(4-chlorobenzoyl)-6,7-dimethoxy-1H-quinolin-4-one. InChIKey: KMNSTGODSMTIJS-UHFFFAOYSA-N.
| Molecular formula | C18H14ClNO4 |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 3-(4-chlorobenzoyl)-6,7-dimethoxy-1H-quinolin-4-one |
| InChIKey | KMNSTGODSMTIJS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=CN2)C(=O)C3=CC=C(C=C3)Cl)OC |
Computed by PubChem (NCBI)