Products 1189920-50-0
CAS 1189920-50-0 appears in our catalog under these names: 2-Amino-9H-pyrido(2,3-b)indole-15N3, >95% (HPLC), AalphaC-15N3. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 5mg, 1 mg, 500 μg, 5 mg.
9H-(115N)pyridino[2,3-b]indol-2-(15N)amine (CAS 1189920-50-0) is a chemical compound with the molecular formula C11H9N3 and a molecular weight of 186.19 g/mol. IUPAC name: 9H-(115N)pyridino[2,3-b]indol-2-(15N)amine. InChIKey: FJTNLJLPLJDTRM-WEQCDQLKSA-N.
| Molecular formula | C11H9N3 |
|---|---|
| Molecular weight | 186.19 g/mol |
| IUPAC name | 9H-(115N)pyridino[2,3-b]indol-2-(15N)amine |
| InChIKey | FJTNLJLPLJDTRM-WEQCDQLKSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C([15NH]2)[15N]=C(C=C3)[15NH2] |
Computed by PubChem (NCBI)