CAS 1189940-96-2 appears in our catalog under these names: Fenbufen-d9, Fenbufen-d9, >95% (HPLC), Fenbufen–d9, D9-Fenbufen, D9-Fenbufen, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Hubei YoungXin, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 1 mg.
4-oxo-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]butanoic acid (CAS 1189940-96-2) is a chemical compound with the molecular formula C16H14O3 and a molecular weight of 263.33 g/mol. IUPAC name: 4-oxo-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]butanoic acid. InChIKey: ZPAKPRAICRBAOD-LOIXRAQWSA-N.
| Molecular formula | C16H14O3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | 4-oxo-4-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]butanoic acid |
| InChIKey | ZPAKPRAICRBAOD-LOIXRAQWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(=C(C(=C2[2H])[2H])C(=O)CCC(=O)O)[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)