CAS 1189943-37-0 appears in our catalog under these names: Prochlorperazine Sulfoxide-d3, >95% (HPLC), Prochlorperazine Sulfoxide–d3, Prochlorperazine Sulfoxide-d3, 99.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2-chloro-10-[3-[4-(trideuteriomethyl)piperazin-1-yl]propyl]phenothiazine 5-oxide (CAS 1189943-37-0) is a chemical compound with the molecular formula C20H24ClN3OS and a molecular weight of 393.0 g/mol. IUPAC name: 2-chloro-10-[3-[4-(trideuteriomethyl)piperazin-1-yl]propyl]phenothiazine 5-oxide. InChIKey: AZGYHFQQUZPAFZ-FIBGUPNXSA-N.
| Molecular formula | C20H24ClN3OS |
|---|---|
| Molecular weight | 393.0 g/mol |
| IUPAC name | 2-chloro-10-[3-[4-(trideuteriomethyl)piperazin-1-yl]propyl]phenothiazine 5-oxide |
| InChIKey | AZGYHFQQUZPAFZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N1CCN(CC1)CCCN2C3=CC=CC=C3S(=O)C4=C2C=C(C=C4)Cl |
Computed by PubChem (NCBI)